cas: 64415-07-2 — see every product listed under this CAS number, including other names
7-(trifluoromethyl)-1,4-dihydroquinoline-4-thione, 97% (CAS 64415-07-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F608580-100MG |
| cas | 64415-07-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 471.73 Pln | |
| Fluorochem | 5g | 2132.60 Pln | |
| Fluorochem | 10g | 3845.54 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-(trifluoromethyl)-1H-quinoline-4-thione (CAS 64415-07-2) is a chemical compound with the molecular formula C10H6F3NS and a molecular weight of 229.22 g/mol. IUPAC name: 7-(trifluoromethyl)-1H-quinoline-4-thione. InChIKey: DBWDEWRMEKXOFI-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NS |
|---|---|
| Molecular weight | 229.22 g/mol |
| IUPAC name | 7-(trifluoromethyl)-1H-quinoline-4-thione |
| InChIKey | DBWDEWRMEKXOFI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)NC=CC2=S |
Computed by PubChem (NCBI)