CAS 544716-08-7 is the registry number for 6-(Trifluoromethyl) Quinoline-4-thiol. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethyl)-1H-quinoline-4-thione (CAS 544716-08-7) is a chemical compound with the molecular formula C10H6F3NS and a molecular weight of 229.22 g/mol. IUPAC name: 6-(trifluoromethyl)-1H-quinoline-4-thione. InChIKey: YJDNFPTZTNGNSH-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NS |
|---|---|
| Molecular weight | 229.22 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1H-quinoline-4-thione |
| InChIKey | YJDNFPTZTNGNSH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C(=S)C=CN2 |
Computed by PubChem (NCBI)