CAS 192063-44-8 is the registry number for 2-[3-(Trifluoromethyl)phenyl]-1,3-thiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-[3-(trifluoromethyl)phenyl]-1,3-thiazole (CAS 192063-44-8) is a chemical compound with the molecular formula C10H6F3NS and a molecular weight of 229.22 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]-1,3-thiazole. InChIKey: QWJXQZVRJPSMLA-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NS |
|---|---|
| Molecular weight | 229.22 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]-1,3-thiazole |
| InChIKey | QWJXQZVRJPSMLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NC=CS2 |
Computed by PubChem (NCBI)