7-Amino-1-tetralone, 97%
cas: 22009-40-1 — see every product listed under this CAS number, including other names
7-Amino-1-tetralone, 97% (CAS 22009-40-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A403835-100mg |
| cas | 22009-40-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1004.50 Pln | |
| Ambeed | 10g | 1933.44 Pln | |
| Ambeed | 25g | 4714.69 Pln | |
| BLDpharm | 100mg | 247.72 Pln | |
| BLDpharm | 250mg | 292.14 Pln | |
| BLDpharm | 1g | 336.57 Pln | |
| BLDpharm | 5g | 1080.76 Pln | |
| BLDpharm | 10g | 2080.40 Pln | |
| BLDpharm | 25g | 5079.35 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
7-amino-3,4-dihydro-2H-naphthalen-1-one (CAS 22009-40-1) is a chemical compound with the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. IUPAC name: 7-amino-3,4-dihydro-2H-naphthalen-1-one. InChIKey: IDNLVJHOEZJNHW-UHFFFAOYSA-N.
| Molecular formula | C10H11NO |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | 7-amino-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | IDNLVJHOEZJNHW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)N)C(=O)C1 |
Computed by PubChem (NCBI)