Products 22009-40-1
CAS 22009-40-1 appears in our catalog under these names: 7–Amino–1–tetralone, 7-Amino-1-tetralone 97%, 7-Amino-alpha-tetralone, 97%, 7-Amino-alpha-tetralone, 7-Amino-a-tetralone. Offered by: GLPBio, Ambeed, Combi-blocks, TRC, Thermo Scientific (Acros). Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g, 2g.
7-amino-3,4-dihydro-2H-naphthalen-1-one (CAS 22009-40-1) is a chemical compound with the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. IUPAC name: 7-amino-3,4-dihydro-2H-naphthalen-1-one. InChIKey: IDNLVJHOEZJNHW-UHFFFAOYSA-N.
| Molecular formula | C10H11NO |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | 7-amino-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | IDNLVJHOEZJNHW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)N)C(=O)C1 |
Computed by PubChem (NCBI)