cas: 957-68-6 — see every product listed under this CAS number, including other names
7-Aminocephalosporanic acid 98% (CAS 957-68-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A183629-25g |
| cas | 957-68-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 153.44 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 987.81 Pln | |
| Ambeed | 1000g | 1744.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A183629 |
7beta-aminocephalosporanic acid is the alpha,beta-unsaturated monocarboxylic acid that is the active nucleus for the synthesis of cephalosporins and intermediates. It is functionally related to a cephalosporanic acid. It is a tautomer of a 7beta-aminocephalosporanic acid zwitterion.
Source: ChEBI
| Molecular formula | C10H12N2O5S |
|---|---|
| Molecular weight | 272.28 g/mol |
| IUPAC name | (6R,7R)-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | HSHGZXNAXBPPDL-HZGVNTEJSA-N |
| SMILES | CC(=O)OCC1=C(N2[C@@H]([C@@H](C2=O)N)SC1)C(=O)O |
Computed by PubChem (NCBI)