CAS 18884-65-6 appears in our catalog under these names: Cefazedone Impurity 10, Cefmenoxime Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
(6R,7R)-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid (CAS 18884-65-6) is a chemical compound with the molecular formula C10H12N2O5S and a molecular weight of 272.28 g/mol. IUPAC name: (6R,7R)-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid. InChIKey: GCWYJKBKERQIRW-HWABHILUSA-N.
| Molecular formula | C10H12N2O5S |
|---|---|
| Molecular weight | 272.28 g/mol |
| IUPAC name | (6R,7R)-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid |
| InChIKey | GCWYJKBKERQIRW-HWABHILUSA-N |
| SMILES | CC(=O)OCC1=CS[C@@H]2[C@@H](C(=O)N2C1C(=O)O)N |
Computed by PubChem (NCBI)