cas: 957-68-6 — see every product listed under this CAS number, including other names
7-Aminocephalosporanic acid, 95%+, 95%+ (CAS 957-68-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NCV-1g |
| cas | 957-68-6 |
| size | 1g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 100g | 165.20 Pln | |
| Chemat | 500g | 638.40 Pln | |
| Chemat | 1kg | 1197.20 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
7beta-aminocephalosporanic acid is the alpha,beta-unsaturated monocarboxylic acid that is the active nucleus for the synthesis of cephalosporins and intermediates. It is functionally related to a cephalosporanic acid. It is a tautomer of a 7beta-aminocephalosporanic acid zwitterion.
Source: ChEBI
| Molecular formula | C10H12N2O5S |
|---|---|
| Molecular weight | 272.28 g/mol |
| IUPAC name | (6R,7R)-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | HSHGZXNAXBPPDL-HZGVNTEJSA-N |
| SMILES | CC(=O)OCC1=C(N2[C@@H]([C@@H](C2=O)N)SC1)C(=O)O |
Computed by PubChem (NCBI)