cas: 864448-41-9 — see every product listed under this CAS number, including other names
7-BOC-3-OXA-7,9-DIAZABICYCLO[3.3.1]NONANE (CAS 864448-41-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468132-100MG |
| cas | 864448-41-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1013.20 Pln | |
| Fluorochem | 250mg | 1945.17 Pln | |
| Fluorochem | 500mg | 3356.13 Pln | |
| Fluorochem | 1g | 5693.85 Pln |
| delivery time | 2-3 weeks |
|---|
Tert-butyl 3-oxa-7,9-diazabicyclo[3.3.1]nonane-7-carboxylate (CAS 864448-41-9) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl 3-oxa-7,9-diazabicyclo[3.3.1]nonane-7-carboxylate. InChIKey: SYYVJJWPPNEPGD-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl 3-oxa-7,9-diazabicyclo[3.3.1]nonane-7-carboxylate |
| InChIKey | SYYVJJWPPNEPGD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2COCC(C1)N2 |
Computed by PubChem (NCBI)