cas: 864448-41-9 — see every product listed under this CAS number, including other names
tert-Butyl 3-oxa-7,9-diazabicyclo[3.3.1]nonane-7-carboxylate, 97%, 97% (CAS 864448-41-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IE3L-100mg |
| cas | 864448-41-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 597.20 Pln | |
| Chemat | 250mg | 1134.80 Pln | |
| Chemat | 500mg | 1936.40 Pln | |
| Chemat | 1g | 3606.80 Pln | |
| Chemat | 5g | 9798.80 Pln | |
| Chemat | 10g | 17925.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-oxa-7,9-diazabicyclo[3.3.1]nonane-7-carboxylate (CAS 864448-41-9) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl 3-oxa-7,9-diazabicyclo[3.3.1]nonane-7-carboxylate. InChIKey: SYYVJJWPPNEPGD-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl 3-oxa-7,9-diazabicyclo[3.3.1]nonane-7-carboxylate |
| InChIKey | SYYVJJWPPNEPGD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2COCC(C1)N2 |
Computed by PubChem (NCBI)