cas: 885281-30-1 — see every product listed under this CAS number, including other names
7-Boc-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylic Acid, 96%, 96% (CAS 885281-30-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NDH-100mg |
| cas | 885281-30-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2358.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
7-[(2-methylpropan-2-yl)oxycarbonyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxylic acid (CAS 885281-30-1) is a chemical compound with the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. IUPAC name: 7-[(2-methylpropan-2-yl)oxycarbonyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxylic acid. InChIKey: YUBMPMRXTOOBIU-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O4 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 7-[(2-methylpropan-2-yl)oxycarbonyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxylic acid |
| InChIKey | YUBMPMRXTOOBIU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C=C(N=C2C1)C(=O)O |
Computed by PubChem (NCBI)