cas: 32281-97-3 — see every product listed under this CAS number, including other names
7-Bromo-1-tetralone 98% (CAS 32281-97-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A104347-1g |
| cas | 32281-97-3 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 281.38 Pln | |
| Ambeed | 100g | 787.56 Pln | |
| Ambeed | 500g | 3429.75 Pln | |
| Ambeed | 1000g | 5443.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A104347 |
7-bromo-3,4-dihydro-2H-naphthalen-1-one (CAS 32281-97-3) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 7-bromo-3,4-dihydro-2H-naphthalen-1-one. InChIKey: YGVDCGFUUUJCDF-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 7-bromo-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | YGVDCGFUUUJCDF-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)Br)C(=O)C1 |
Computed by PubChem (NCBI)