CAS 32281-97-3 appears in our catalog under these names: 7-Bromo-1-tetralone, 97% , 7-Bromo-1-tetralone, 97%, 7–Bromotetralone, 7-Bromo-1-tetralone, >95.0%(GC), 7-Bromo-1-tetralone. Offered by: Thermo Scientific (Alfa Aesar), Fluorochem, GLPBio, TCI, Biosynth. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 100mg, 250mg.
7-bromo-3,4-dihydro-2H-naphthalen-1-one (CAS 32281-97-3) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 7-bromo-3,4-dihydro-2H-naphthalen-1-one. InChIKey: YGVDCGFUUUJCDF-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 7-bromo-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | YGVDCGFUUUJCDF-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)Br)C(=O)C1 |
Computed by PubChem (NCBI)