cas: 108061-47-8 — see every product listed under this CAS number, including other names
7-Bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole 95% (CAS 108061-47-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A418221-50mg |
| cas | 108061-47-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 1377.19 Pln | |
| Ambeed | 100mg | 1638.62 Pln | |
| Ambeed | 250mg | 2689.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A418221 |
7-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (CAS 108061-47-8) is a chemical compound with the molecular formula C11H11BrN2 and a molecular weight of 251.12 g/mol. IUPAC name: 7-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole. InChIKey: XAHAQVIJZAMMLO-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2 |
|---|---|
| Molecular weight | 251.12 g/mol |
| IUPAC name | 7-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| InChIKey | XAHAQVIJZAMMLO-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C3=C(N2)C=C(C=C3)Br |
Computed by PubChem (NCBI)