cas: 5043-14-1 — see every product listed under this CAS number, including other names
7-Bromo-2-naphthoic acid 97% (CAS 5043-14-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A811783-50mg |
| cas | 5043-14-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 281.38 Pln | |
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1432.81 Pln | |
| Ambeed | 5g | 4759.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A811783 |
7-bromonaphthalene-2-carboxylic acid (CAS 5043-14-1) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 7-bromonaphthalene-2-carboxylic acid. InChIKey: LFABKBCBWUOHGM-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 7-bromonaphthalene-2-carboxylic acid |
| InChIKey | LFABKBCBWUOHGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)