7-Bromo-2-naphthoic acid, 95%
cas: 5043-14-1 — see every product listed under this CAS number, including other names
7-Bromo-2-naphthoic acid, 95% (CAS 5043-14-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 100mg, 50mg, 500mg, 5g, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | JG-0883-1g |
| cas | 5043-14-1 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 100mg | price on request | |
| Fluorochem | 50mg | 263.47 Pln | |
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 549.82 Pln | |
| Fluorochem | 500mg | 877.83 Pln | |
| Fluorochem | 1g | 1424.52 Pln | |
| Fluorochem | 5g | 5110.72 Pln | |
| Fluorochem | 10g | 9598.72 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
7-bromonaphthalene-2-carboxylic acid (CAS 5043-14-1) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 7-bromonaphthalene-2-carboxylic acid. InChIKey: LFABKBCBWUOHGM-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 7-bromonaphthalene-2-carboxylic acid |
| InChIKey | LFABKBCBWUOHGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)