cas: 132095-54-6 — see every product listed under this CAS number, including other names
7-Bromo-2-tetralone, 97% (CAS 132095-54-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216847-100MG |
| cas | 132095-54-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 138.51 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 976.76 Pln | |
| Fluorochem | 10g | 1893.10 Pln | |
| Fluorochem | 25g | 4048.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-bromo-3,4-dihydro-1H-naphthalen-2-one (CAS 132095-54-6) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 7-bromo-3,4-dihydro-1H-naphthalen-2-one. InChIKey: NCTYMQMYDHAKCE-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 7-bromo-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | NCTYMQMYDHAKCE-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)