cas: 195986-74-4 — see every product listed under this CAS number, including other names
7-Bromo-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione, 97%, 97% (CAS 195986-74-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11APND-250mg |
| cas | 195986-74-4 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 515.60 Pln | |
| Chemat | 5g | 1710.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-bromo-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (CAS 195986-74-4) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 7-bromo-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione. InChIKey: QTLHJODGGBYWLC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 7-bromo-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| InChIKey | QTLHJODGGBYWLC-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=C(C=C2)Br)C(=O)N1 |
Computed by PubChem (NCBI)