cas: 1273596-20-5 — see every product listed under this CAS number, including other names
7-Bromo-3-oxo-2,3-dihydro-1H-indene-5-carboxylic acid, 95%, 95% (CAS 1273596-20-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HRP5-100mg |
| cas | 1273596-20-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 453.20 Pln | |
| Chemat | 1g | 1629.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-bromo-3-oxo-1,2-dihydroindene-5-carboxylic acid (CAS 1273596-20-5) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: 7-bromo-3-oxo-1,2-dihydroindene-5-carboxylic acid. InChIKey: HYDNZQPQWFHSEP-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO3 |
|---|---|
| Molecular weight | 255.06 g/mol |
| IUPAC name | 7-bromo-3-oxo-1,2-dihydroindene-5-carboxylic acid |
| InChIKey | HYDNZQPQWFHSEP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=CC(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)