cas: 1311275-33-8 — see every product listed under this CAS number, including other names
7-Bromo-5H-pyrrolo(3,2-d)pyrimidin-4-amine, 97% (CAS 1311275-33-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A585185-1g |
| cas | 1311275-33-8 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6925.03 Pln | |
| AmBeed | 10g | 22529.50 Pln | |
| AmBeed | 5g | 14984.41 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-bromo-5H-pyrrolo[3,2-d]pyrimidin-4-amine (CAS 1311275-33-8) is a chemical compound with the molecular formula C6H5BrN4 and a molecular weight of 213.03 g/mol. IUPAC name: 7-bromo-5H-pyrrolo[3,2-d]pyrimidin-4-amine. InChIKey: SKJNVSMBUJLYOI-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN4 |
|---|---|
| Molecular weight | 213.03 g/mol |
| IUPAC name | 7-bromo-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
| InChIKey | SKJNVSMBUJLYOI-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(N1)C(=NC=N2)N)Br |
Computed by PubChem (NCBI)