cas: 1311275-33-8 — see every product listed under this CAS number, including other names
7-Bromo-5H-pyrrolo[3,2-d]pyrimidin-4-amine, 98%, 98% (CAS 1311275-33-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g, 15g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111VKG-250mg |
| cas | 1311275-33-8 |
| size | 250mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 5g | 606.80 Pln | |
| Chemat | 10g | 1130.00 Pln | |
| Chemat | 15g | 1614.80 Pln | |
| Chemat | 25g | 2555.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-bromo-5H-pyrrolo[3,2-d]pyrimidin-4-amine (CAS 1311275-33-8) is a chemical compound with the molecular formula C6H5BrN4 and a molecular weight of 213.03 g/mol. IUPAC name: 7-bromo-5H-pyrrolo[3,2-d]pyrimidin-4-amine. InChIKey: SKJNVSMBUJLYOI-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN4 |
|---|---|
| Molecular weight | 213.03 g/mol |
| IUPAC name | 7-bromo-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
| InChIKey | SKJNVSMBUJLYOI-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(N1)C(=NC=N2)N)Br |
Computed by PubChem (NCBI)