cas: 52333-42-3 — see every product listed under this CAS number, including other names
7-Bromopyrido[2,3-b]pyrazine 97% (CAS 52333-42-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A279233-250mg |
| cas | 52333-42-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 687.44 Pln | |
| Ambeed | 10g | 1265.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A279233 |
7-bromopyrido[2,3-b]pyrazine (CAS 52333-42-3) is a chemical compound with the molecular formula C7H4BrN3 and a molecular weight of 210.03 g/mol. IUPAC name: 7-bromopyrido[2,3-b]pyrazine. InChIKey: YEDMUIQRKXNDQI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3 |
|---|---|
| Molecular weight | 210.03 g/mol |
| IUPAC name | 7-bromopyrido[2,3-b]pyrazine |
| InChIKey | YEDMUIQRKXNDQI-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C=C(C=N2)Br |
Computed by PubChem (NCBI)