cas: 129295-32-5 — see every product listed under this CAS number, including other names
7-CHLORO-1H-INDAZOLE-3-CARBOXYLIC ACID, 98% (CAS 129295-32-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F793320-100MG |
| cas | 129295-32-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 815.36 Pln | |
| Fluorochem | 5g | 3173.90 Pln | |
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 815.36 Pln | |
| Fluorochem | 5g | 3173.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
7-chloro-2H-indazole-3-carboxylic acid (CAS 129295-32-5) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 7-chloro-2H-indazole-3-carboxylic acid. InChIKey: HVKKAELOIRDAAI-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 7-chloro-2H-indazole-3-carboxylic acid |
| InChIKey | HVKKAELOIRDAAI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C(=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)