CAS 552331-43-8 appears in our catalog under these names: 7-Chloropyrido(2,3-d)pyrimidin-4-ol, 7-Chloropyrido[2,3-d]pyrimidin-4-ol, 95%, 95%, 7-chloro-1H,4H-pyrido[2,3-d]pyrimidin-4-one, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g.
7-chloro-3H-pyrido[2,3-d]pyrimidin-4-one (CAS 552331-43-8) is a chemical compound with the molecular formula C7H4ClN3O and a molecular weight of 181.58 g/mol. IUPAC name: 7-chloro-3H-pyrido[2,3-d]pyrimidin-4-one. InChIKey: IGUXDXKIOOOGCJ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O |
|---|---|
| Molecular weight | 181.58 g/mol |
| IUPAC name | 7-chloro-3H-pyrido[2,3-d]pyrimidin-4-one |
| InChIKey | IGUXDXKIOOOGCJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=O)NC=N2)Cl |
Computed by PubChem (NCBI)