cas: 1283090-73-2 — see every product listed under this CAS number, including other names
7-Fluoro-1H-spiro[furo[3,4-c]pyridine-3,4'-piperidine], 95%, 95% (CAS 1283090-73-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111XYF-100mg |
| cas | 1283090-73-2 |
| size | 100mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 3947.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine] (CAS 1283090-73-2) is a chemical compound with the molecular formula C11H13FN2O and a molecular weight of 208.23 g/mol. IUPAC name: 7-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]. InChIKey: NNKWGFJKKMMYSU-UHFFFAOYSA-N.
| Molecular formula | C11H13FN2O |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | 7-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine] |
| InChIKey | NNKWGFJKKMMYSU-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=CN=CC(=C3CO2)F |
Computed by PubChem (NCBI)