Products 1286207-57-5
CAS 1286207-57-5 appears in our catalog under these names: (S)-(3-Aminopyrrolidin-1-yl)(4-fluorophenyl)methanone, 95%, (3S)-1-(4-Fluorobenzoyl)pyrrolidin-3-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
[(3S)-3-aminopyrrolidin-1-yl]-(4-fluorophenyl)methanone (CAS 1286207-57-5) is a chemical compound with the molecular formula C11H13FN2O and a molecular weight of 208.23 g/mol. IUPAC name: [(3S)-3-aminopyrrolidin-1-yl]-(4-fluorophenyl)methanone. InChIKey: SNSRVOBBDAUXAP-JTQLQIEISA-N.
| Molecular formula | C11H13FN2O |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | [(3S)-3-aminopyrrolidin-1-yl]-(4-fluorophenyl)methanone |
| InChIKey | SNSRVOBBDAUXAP-JTQLQIEISA-N |
| SMILES | C1CN(C[C@H]1N)C(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)