CAS 334477-18-8 is the registry number for (S)-3-(4-Fluoro-2-methylphenyl)piperazin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(3S)-3-(4-fluoro-2-methylphenyl)piperazin-2-one (CAS 334477-18-8) is a chemical compound with the molecular formula C11H13FN2O and a molecular weight of 208.23 g/mol. IUPAC name: (3S)-3-(4-fluoro-2-methylphenyl)piperazin-2-one. InChIKey: DFUGUOHNKOIDMN-JTQLQIEISA-N.
| Molecular formula | C11H13FN2O |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | (3S)-3-(4-fluoro-2-methylphenyl)piperazin-2-one |
| InChIKey | DFUGUOHNKOIDMN-JTQLQIEISA-N |
| SMILES | CC1=C(C=CC(=C1)F)[C@H]2C(=O)NCCN2 |
Computed by PubChem (NCBI)