cas: 49573-30-0 — see every product listed under this CAS number, including other names
7-Formylquinoline, 98%, 98% (CAS 49573-30-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NFE-100mg |
| cas | 49573-30-0 |
| size | 100mg |
| availability | 40.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1442.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Quinoline-7-carbaldehyde (CAS 49573-30-0) is a chemical compound with the molecular formula C10H7NO and a molecular weight of 157.17 g/mol. IUPAC name: quinoline-7-carbaldehyde. InChIKey: WINWAFCAQPFBQA-UHFFFAOYSA-N.
| Molecular formula | C10H7NO |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | quinoline-7-carbaldehyde |
| InChIKey | WINWAFCAQPFBQA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)C=O)N=C1 |
Computed by PubChem (NCBI)