cas: 49573-30-0 — see every product listed under this CAS number, including other names
Quinoline-7-carbaldehyde 98% (CAS 49573-30-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A726349-100mg |
| cas | 49573-30-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 348.12 Pln | |
| Ambeed | 5g | 1455.06 Pln | |
| Ambeed | 10g | 2283.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A726349 |
Quinoline-7-carbaldehyde (CAS 49573-30-0) is a chemical compound with the molecular formula C10H7NO and a molecular weight of 157.17 g/mol. IUPAC name: quinoline-7-carbaldehyde. InChIKey: WINWAFCAQPFBQA-UHFFFAOYSA-N.
| Molecular formula | C10H7NO |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | quinoline-7-carbaldehyde |
| InChIKey | WINWAFCAQPFBQA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)C=O)N=C1 |
Computed by PubChem (NCBI)