cas: 19037-69-5 — see every product listed under this CAS number, including other names
7-Hydroxy-4-methyl-8-nitro-2H-chromen-2-one (CAS 19037-69-5) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113EIB-5mg |
| cas | 19037-69-5 |
| size | 5mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 232.40 Pln | |
| Chemat | 1g | 395.60 Pln | |
| Chemat | 5g | 1230.80 Pln |
| delivery time | 3 weeks |
|---|
7-hydroxy-4-methyl-8-nitrochromen-2-one (CAS 19037-69-5) is a chemical compound with the molecular formula C10H7NO5 and a molecular weight of 221.17 g/mol. IUPAC name: 7-hydroxy-4-methyl-8-nitrochromen-2-one. InChIKey: BGUBUSIGKOWDPO-UHFFFAOYSA-N.
| Molecular formula | C10H7NO5 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 7-hydroxy-4-methyl-8-nitrochromen-2-one |
| InChIKey | BGUBUSIGKOWDPO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2[N+](=O)[O-])O |
Computed by PubChem (NCBI)