cas: 19037-69-5 — see every product listed under this CAS number, including other names
7-Hydroxy-4-methyl-8-nitrocoumarin, 99.71% (CAS 19037-69-5) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 100 mg, 50 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-N6657-10mM/1mL |
| cas | 19037-69-5 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 407.93 Pln | |
| MedChemExpress | 100 mg | 551.89 Pln | |
| MedChemExpress | 50 mg | 384.71 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.71% |
7-hydroxy-4-methyl-8-nitrochromen-2-one (CAS 19037-69-5) is a chemical compound with the molecular formula C10H7NO5 and a molecular weight of 221.17 g/mol. IUPAC name: 7-hydroxy-4-methyl-8-nitrochromen-2-one. InChIKey: BGUBUSIGKOWDPO-UHFFFAOYSA-N.
| Molecular formula | C10H7NO5 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 7-hydroxy-4-methyl-8-nitrochromen-2-one |
| InChIKey | BGUBUSIGKOWDPO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2[N+](=O)[O-])O |
Computed by PubChem (NCBI)