cas: 383132-25-0 — see every product listed under this CAS number, including other names
7-Isopropyl-1H-indole-2-carboxylic acid, 95%, 95% (CAS 383132-25-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118AA8-100mg |
| cas | 383132-25-0 |
| size | 100mg |
| availability | 1.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 501.20 Pln | |
| Chemat | 1g | 1821.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-propan-2-yl-1H-indole-2-carboxylic acid (CAS 383132-25-0) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 7-propan-2-yl-1H-indole-2-carboxylic acid. InChIKey: FDRHWXHKWSSVBJ-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 7-propan-2-yl-1H-indole-2-carboxylic acid |
| InChIKey | FDRHWXHKWSSVBJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=CC2=C1NC(=C2)C(=O)O |
Computed by PubChem (NCBI)