cas: 35338-72-8 — see every product listed under this CAS number, including other names
7-Isopropyl-3,4-dihydronaphthalen-1(2H)-one 97% (CAS 35338-72-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A391186-50mg |
| cas | 35338-72-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 470.50 Pln | |
| Ambeed | 100mg | 654.06 Pln | |
| Ambeed | 250mg | 1082.38 Pln | |
| Ambeed | 1g | 2806.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A391186 |
7-propan-2-yl-3,4-dihydro-2H-naphthalen-1-one (CAS 35338-72-8) is a chemical compound with the molecular formula C13H16O and a molecular weight of 188.26 g/mol. IUPAC name: 7-propan-2-yl-3,4-dihydro-2H-naphthalen-1-one. InChIKey: FTTPUMZADACVGJ-UHFFFAOYSA-N.
| Molecular formula | C13H16O |
|---|---|
| Molecular weight | 188.26 g/mol |
| IUPAC name | 7-propan-2-yl-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | FTTPUMZADACVGJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(CCCC2=O)C=C1 |
Computed by PubChem (NCBI)