cas: 1240526-05-9 — see every product listed under this CAS number, including other names
7-Methanesulfonyl-1,2,3,4-tetrahydroquinoline, 98%, 98% (CAS 1240526-05-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12A9X2-100mg |
| cas | 1240526-05-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 846.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-methylsulfonyl-1,2,3,4-tetrahydroquinoline (CAS 1240526-05-9) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: 7-methylsulfonyl-1,2,3,4-tetrahydroquinoline. InChIKey: JIRLKZNBXVTGIF-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 7-methylsulfonyl-1,2,3,4-tetrahydroquinoline |
| InChIKey | JIRLKZNBXVTGIF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(CCCN2)C=C1 |
Computed by PubChem (NCBI)