CAS 35889-69-1 appears in our catalog under these names: N-(1,1-Dioxidotetrahydrothien-3-yl)-n-phenylamine, 95%, 3-(Phenylamino)tetrahydrothiophene 1,1-dioxide, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1,1-dioxo-N-phenylthiolan-3-amine (CAS 35889-69-1) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: 1,1-dioxo-N-phenylthiolan-3-amine. InChIKey: BGIRRCNOGXPKCK-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 1,1-dioxo-N-phenylthiolan-3-amine |
| InChIKey | BGIRRCNOGXPKCK-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1NC2=CC=CC=C2 |
Computed by PubChem (NCBI)