cas: 1240526-05-9 — see every product listed under this CAS number, including other names
7-Methanesulfonyl-1,2,3,4-tetrahydroquinoline, 98% (CAS 1240526-05-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1115488-50mg |
| cas | 1240526-05-9 |
| size | 50mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 50mg | 538.72 Pln | |
| AmBeed | 5g | 10863.58 Pln | |
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 471.73 Pln | |
| Fluorochem | 1g | 1315.18 Pln | |
| Fluorochem | 5g | 6344.66 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-methylsulfonyl-1,2,3,4-tetrahydroquinoline (CAS 1240526-05-9) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: 7-methylsulfonyl-1,2,3,4-tetrahydroquinoline. InChIKey: JIRLKZNBXVTGIF-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 7-methylsulfonyl-1,2,3,4-tetrahydroquinoline |
| InChIKey | JIRLKZNBXVTGIF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(CCCN2)C=C1 |
Computed by PubChem (NCBI)