CAS 960505-77-5 appears in our catalog under these names: 7-Methyl-6-nitro-imidazo[1,2-a]pyridine, 95%, 7-Methyl-6-Nitro-Imidazo[1,2-A]Pyridine, 98%, 98%, 7-METHYL-6-NITRO-IMIDAZO[1,2-A]PYRIDINE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
7-methyl-6-nitroimidazo[1,2-a]pyridine (CAS 960505-77-5) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 7-methyl-6-nitroimidazo[1,2-a]pyridine. InChIKey: DUHWKOXBDNMSET-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 7-methyl-6-nitroimidazo[1,2-a]pyridine |
| InChIKey | DUHWKOXBDNMSET-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC=CN2C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)