cas: 1127-59-9 — see every product listed under this CAS number, including other names
7-Methylisatin 97% (CAS 1127-59-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A125670-250mg |
| cas | 1127-59-9 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 659.62 Pln | |
| Ambeed | 500g | 2439.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A125670 |
7-methyl-1H-indole-2,3-dione (CAS 1127-59-9) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 7-methyl-1H-indole-2,3-dione. InChIKey: UEHZKEABUOAZSH-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 7-methyl-1H-indole-2,3-dione |
| InChIKey | UEHZKEABUOAZSH-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)