CAS 1127-59-9 appears in our catalog under these names: Ramosetron Impurity 15 (7-Methylisatin), 7–Methylisatin, 7-Methylindoline-2,3-dione, >98.0%(GC), 7-Methylisatin, 7-Methylisatin 97%. Offered by: Chemat Brand, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: on request, 100g, 25g, 5g, 10g, 50g, 250mg, 1g.
7-methyl-1H-indole-2,3-dione (CAS 1127-59-9) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 7-methyl-1H-indole-2,3-dione. InChIKey: UEHZKEABUOAZSH-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 7-methyl-1H-indole-2,3-dione |
| InChIKey | UEHZKEABUOAZSH-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)