cas: 660823-32-5 — see every product listed under this CAS number, including other names
7-NITROINDAZOLE-3-CARBOXYLIC ACID, 97% (CAS 660823-32-5) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467785-500MG |
| cas | 660823-32-5 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1705.67 Pln | |
| Fluorochem | 1g | 3184.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-nitro-2H-indazole-3-carboxylic acid (CAS 660823-32-5) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 7-nitro-2H-indazole-3-carboxylic acid. InChIKey: OEVZNTWOQBYJQU-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 7-nitro-2H-indazole-3-carboxylic acid |
| InChIKey | OEVZNTWOQBYJQU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C(=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)