CAS 59827-85-9 is the registry number for 5-Amino-6-nitroisoindoline-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
5-amino-6-nitroisoindole-1,3-dione (CAS 59827-85-9) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 5-amino-6-nitroisoindole-1,3-dione. InChIKey: JOPWCYFGRYCBEF-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 5-amino-6-nitroisoindole-1,3-dione |
| InChIKey | JOPWCYFGRYCBEF-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1N)[N+](=O)[O-])C(=O)NC2=O |
Computed by PubChem (NCBI)