Products 660823-32-5
CAS 660823-32-5 appears in our catalog under these names: 7-Nitro-1h-indazole-3-carboxylic acid, 95%, 7-Nitro-1H-indazole-3-carboxylic Acid, 7-Nitro-1H-indazole-3-carboxylic acid, 97%, 7-NITROINDAZOLE-3-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, TRC, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
7-nitro-2H-indazole-3-carboxylic acid (CAS 660823-32-5) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 7-nitro-2H-indazole-3-carboxylic acid. InChIKey: OEVZNTWOQBYJQU-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 7-nitro-2H-indazole-3-carboxylic acid |
| InChIKey | OEVZNTWOQBYJQU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C(=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)