CAS 68820-12-2 is the registry number for 7-[(4-Methylphenyl)sulfonyl]-7-azabicyclo[4.1.0]heptane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptane (CAS 68820-12-2) is a chemical compound with the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. IUPAC name: 7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptane. InChIKey: NIVBPVMTZHYBFT-UHFFFAOYSA-N.
| Molecular formula | C13H17NO2S |
|---|---|
| Molecular weight | 251.35 g/mol |
| IUPAC name | 7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptane |
| InChIKey | NIVBPVMTZHYBFT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C3C2CCCC3 |
Computed by PubChem (NCBI)