cas: 1803608-20-9 — see every product listed under this CAS number, including other names
7-tert-butoxycarbonyl-2-oxa-7-azaspiro[3.4]octane-5-carboxylic acid, 98%, 98% (CAS 1803608-20-9) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 250mg, 500mg, 1g, 5g, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BCEB-10mg |
| cas | 1803608-20-9 |
| size | 10mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 208.40 Pln | |
| Chemat | 100mg | 1120.40 Pln | |
| Chemat | 250mg | 1754.00 Pln | |
| Chemat | 500mg | 2886.80 Pln | |
| Chemat | 1g | 4298.00 Pln | |
| Chemat | 5g | 15779.60 Pln | |
| Chemat | 25mg | 371.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxa-7-azaspiro[3.4]octane-5-carboxylic acid (CAS 1803608-20-9) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: 7-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxa-7-azaspiro[3.4]octane-5-carboxylic acid. InChIKey: KOEYCRLDXMOAJA-UHFFFAOYSA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 7-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxa-7-azaspiro[3.4]octane-5-carboxylic acid |
| InChIKey | KOEYCRLDXMOAJA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C2(C1)COC2)C(=O)O |
Computed by PubChem (NCBI)