cas: 708274-37-7 — see every product listed under this CAS number, including other names
8-(5-Bromo-2-pyridyl)-8-hydroxy-1,4-dioxaspiro[4.5]decane, ≥95%, ≥95% (CAS 708274-37-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IC4X-100mg |
| cas | 708274-37-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 630.80 Pln | |
| Chemat | 1g | 818.00 Pln | |
| Chemat | 5g | 1840.40 Pln | |
| Chemat | 10g | 3261.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
8-(5-bromo-2-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol (CAS 708274-37-7) is a chemical compound with the molecular formula C13H16BrNO3 and a molecular weight of 314.17 g/mol. IUPAC name: 8-(5-bromo-2-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol. InChIKey: LMXWFQPXVACYFQ-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO3 |
|---|---|
| Molecular weight | 314.17 g/mol |
| IUPAC name | 8-(5-bromo-2-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol |
| InChIKey | LMXWFQPXVACYFQ-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1(C3=NC=C(C=C3)Br)O)OCCO2 |
Computed by PubChem (NCBI)