CAS 1092460-53-1 is the registry number for tert-Butyl 5-bromo-4-hydroxyindoline-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl 5-bromo-4-hydroxy-2,3-dihydroindole-1-carboxylate (CAS 1092460-53-1) is a chemical compound with the molecular formula C13H16BrNO3 and a molecular weight of 314.17 g/mol. IUPAC name: tert-butyl 5-bromo-4-hydroxy-2,3-dihydroindole-1-carboxylate. InChIKey: QYERGTSMRWEZEL-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO3 |
|---|---|
| Molecular weight | 314.17 g/mol |
| IUPAC name | tert-butyl 5-bromo-4-hydroxy-2,3-dihydroindole-1-carboxylate |
| InChIKey | QYERGTSMRWEZEL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1C=CC(=C2O)Br |
Computed by PubChem (NCBI)