Products 341521-29-7
CAS 341521-29-7 appears in our catalog under these names: N-BOC 2-Acetyl-4-bromoaniline, 98%, tert-Butyl (2-acetyl-4-bromophenyl)carbamate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Tert-butyl N-(2-acetyl-4-bromophenyl)carbamate (CAS 341521-29-7) is a chemical compound with the molecular formula C13H16BrNO3 and a molecular weight of 314.17 g/mol. IUPAC name: tert-butyl N-(2-acetyl-4-bromophenyl)carbamate. InChIKey: CCFLQYMUDYKGQO-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO3 |
|---|---|
| Molecular weight | 314.17 g/mol |
| IUPAC name | tert-butyl N-(2-acetyl-4-bromophenyl)carbamate |
| InChIKey | CCFLQYMUDYKGQO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)Br)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)