cas: 1204809-88-0 — see every product listed under this CAS number, including other names
8-(tert-Butyl) 3-methyl 8-azabicyclo[3.2.1]octane-3,8-dicarboxylate 95% (CAS 1204809-88-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A2010212-100mg |
| cas | 1204809-88-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 793.12 Pln | |
| Ambeed | 5g | 1989.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A2010212 |
8-O-tert-butyl 3-O-methyl 8-azabicyclo[3.2.1]octane-3,8-dicarboxylate (CAS 1204809-88-0) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 8-O-tert-butyl 3-O-methyl 8-azabicyclo[3.2.1]octane-3,8-dicarboxylate. InChIKey: AMBCTFGOVMCGIL-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 8-O-tert-butyl 3-O-methyl 8-azabicyclo[3.2.1]octane-3,8-dicarboxylate |
| InChIKey | AMBCTFGOVMCGIL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(C2)C(=O)OC |
Computed by PubChem (NCBI)