cas: 1222996-05-5 — see every product listed under this CAS number, including other names
8-AZABICYCLO[3.2.1]OCTANE-3,8-DICARBOXYLIC ACID, 8-(1,1-DIMETHYLETHYL) ESTER, (3-ENDO)-, 97% (CAS 1222996-05-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F502570-100MG |
| cas | 1222996-05-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 560.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(1R,5S)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid (CAS 1222996-05-5) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: (1R,5S)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid. InChIKey: HKXICUDOIXLKLJ-PBINXNQUSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (1R,5S)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid |
| InChIKey | HKXICUDOIXLKLJ-PBINXNQUSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC(C2)C(=O)O |
Computed by PubChem (NCBI)