cas: 155057-97-9 — see every product listed under this CAS number, including other names
8-Bromo-1,6-naphthyridin-5(6H)-one 98% (CAS 155057-97-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A325579-100mg |
| cas | 155057-97-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2189.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A325579 |
8-bromo-6H-1,6-naphthyridin-5-one (CAS 155057-97-9) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 8-bromo-6H-1,6-naphthyridin-5-one. InChIKey: WYXKOZHBOLUXGU-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 8-bromo-6H-1,6-naphthyridin-5-one |
| InChIKey | WYXKOZHBOLUXGU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CNC2=O)Br)N=C1 |
Computed by PubChem (NCBI)